C21H25N3O6 — CID 8835474
[(Z)-[amino-(3,4-dimethoxyphenyl)methylidene]amino] 4-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]butanoate (PubChem CID 8835474) has the molecular formula C21H25N3O6 and a molecular weight of 415.45 g/mol. Its IUPAC name is [(Z)-[amino-(3,4-dimethoxyphenyl)methylidene]amino] 4-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]butanoate.
| Compound Name | [(Z)-[amino-(3,4-dimethoxyphenyl)methylidene]amino] 4-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]butanoate |
|---|---|
| PubChem CID | 8835474 |
| Molecular Formula | C21H25N3O6 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | [(Z)-[amino-(3,4-dimethoxyphenyl)methylidene]amino] 4-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]butanoate |
| SMILES | COc1ccc(/C(N)=N/OC(=O)CCCN2C(=O)[C@H]3CC=CC[C@H]3C2=O)cc1OC |
| InChI | InChI=1S/C21H25N3O6/c1-28-16-10-9-13(12-17(16)29-2)19(22)23-30-18(25)8-5-11-24-20(26)14-6-3-4-7-15(14)21(24)27/h3-4,9-10,12,14-15H,5-8,11H2,1-2H3,(H2,22,23)/t14-,15+ |
| InChIKey | TXXBZCJMCQQBMG-GASCZTMLSA-N |
| XLogP | 1.60 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|