C18H20N4O4 — CID 8835508
[(Z)-[amino(pyridin-4-yl)methylidene]amino] 4-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]butanoate (PubChem CID 8835508) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is [(Z)-[amino(pyridin-4-yl)methylidene]amino] 4-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]butanoate.
| Compound Name | [(Z)-[amino(pyridin-4-yl)methylidene]amino] 4-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]butanoate |
|---|---|
| PubChem CID | 8835508 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | [(Z)-[amino(pyridin-4-yl)methylidene]amino] 4-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]butanoate |
| SMILES | N/C(=N\OC(=O)CCCN1C(=O)[C@H]2CC=CC[C@@H]2C1=O)c1ccncc1 |
| InChI | InChI=1S/C18H20N4O4/c19-16(12-7-9-20-10-8-12)21-26-15(23)6-3-11-22-17(24)13-4-1-2-5-14(13)18(22)25/h1-2,7-10,13-14H,3-6,11H2,(H2,19,21)/t13-,14-/m0/s1 |
| InChIKey | RCZSDBFSTDUKBN-KBPBESRZSA-N |
| XLogP | 0.98 |
| TPSA | 114.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|