C17H12BrFN2O3 — CID 8837449
[(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 2-bromo-4-fluorobenzoate (PubChem CID 8837449) has the molecular formula C17H12BrFN2O3 and a molecular weight of 391.20 g/mol. Its IUPAC name is [(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 2-bromo-4-fluorobenzoate.
| Compound Name | [(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 2-bromo-4-fluorobenzoate |
|---|---|
| PubChem CID | 8837449 |
| Molecular Formula | C17H12BrFN2O3 |
| Molecular Weight | 391.20 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | [(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 2-bromo-4-fluorobenzoate |
| SMILES | C[C@H](OC(=O)c1ccc(F)cc1Br)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C17H12BrFN2O3/c1-10(16(22)21-13-4-2-3-11(7-13)9-20)24-17(23)14-6-5-12(19)8-15(14)18/h2-8,10H,1H3,(H,21,22)/t10-/m0/s1 |
| InChIKey | KJUHBHUCGNAOGG-JTQLQIEISA-N |
| XLogP | 3.64 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.20 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |