C19H19N3OS2 — CID 8838612
2,3-dimethyl-N-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 8838612) has the molecular formula C19H19N3OS2 and a molecular weight of 369.52 g/mol. Its IUPAC name is 2,3-dimethyl-N-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2,3-dimethyl-N-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 8838612 |
| Molecular Formula | C19H19N3OS2 |
| Molecular Weight | 369.52 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2,3-dimethyl-N-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | Cc1ccc(CSc2nnc(NC(=O)c3cccc(C)c3C)s2)cc1 |
| InChI | InChI=1S/C19H19N3OS2/c1-12-7-9-15(10-8-12)11-24-19-22-21-18(25-19)20-17(23)16-6-4-5-13(2)14(16)3/h4-10H,11H2,1-3H3,(H,20,21,23) |
| InChIKey | SJLKEDZARZCELF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|