C18H17FN2O4S2 — CID 8838723
N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]-4-fluoro-1-benzothiophene-2-carboxamide (PubChem CID 8838723) has the molecular formula C18H17FN2O4S2 and a molecular weight of 408.48 g/mol. Its IUPAC name is N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]-4-fluoro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]-4-fluoro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 8838723 |
| Molecular Formula | C18H17FN2O4S2 |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]-4-fluoro-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)C)cc1NC(=O)c1cc2c(F)cccc2s1 |
| InChI | InChI=1S/C18H17FN2O4S2/c1-21(2)27(23,24)11-7-8-15(25-3)14(9-11)20-18(22)17-10-12-13(19)5-4-6-16(12)26-17/h4-10H,1-3H3,(H,20,22) |
| InChIKey | VQRMUDIPLORZCE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |