About (E)-1,4-bis(4-methylphenyl)but-2-ene-1,4-dione
(E)-1,4-bis(4-methylphenyl)but-2-ene-1,4-dione (PubChem CID 883995) has the molecular formula C18H16O2
and a molecular weight of 264.32 g/mol. Its IUPAC name is (E)-1,4-bis(4-methylphenyl)but-2-ene-1,4-dione.
Molecular Properties
| Compound Name | (E)-1,4-bis(4-methylphenyl)but-2-ene-1,4-dione |
| PubChem CID | 883995 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (E)-1,4-bis(4-methylphenyl)but-2-ene-1,4-dione |
| SMILES | Cc1ccc(C(=O)/C=C/C(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H16O2/c1-13-3-7-15(8-4-13)17(19)11-12-18(20)16-9-5-14(2)6-10-16/h3-12H,1-2H3/b12-11+ |
| InChIKey | XHTZEZLDTOKEGI-VAWYXSNFSA-N |
| XLogP | 3.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,4-bis(4-methylphenyl)but-2-ene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,4-bis(4-methylphenyl)but-2-ene-1,4-dione?
The IUPAC name of (E)-1,4-bis(4-methylphenyl)but-2-ene-1,4-dione (CID 883995) is (E)-1,4-bis(4-methylphenyl)but-2-ene-1,4-dione.
What is the SMILES notation for (E)-1,4-bis(4-methylphenyl)but-2-ene-1,4-dione?
The canonical SMILES for (E)-1,4-bis(4-methylphenyl)but-2-ene-1,4-dione is Cc1ccc(C(=O)/C=C/C(=O)c2ccc(C)cc2)cc1.
What is the InChIKey of (E)-1,4-bis(4-methylphenyl)but-2-ene-1,4-dione?
The InChIKey is XHTZEZLDTOKEGI-VAWYXSNFSA-N. The full InChI is InChI=1S/C18H16O2/c1-13-3-7-15(8-4-13)17(19)11-12-18(20)16-9-5-14(2)6-10-16/h3-12H,1-2H3/b12-11+.
What are the key properties of (E)-1,4-bis(4-methylphenyl)but-2-ene-1,4-dione?
(E)-1,4-bis(4-methylphenyl)but-2-ene-1,4-dione has a molecular weight of 264.32 g/mol, XLogP of 3.93, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,4-bis(4-methylphenyl)but-2-ene-1,4-dione is sourced from PubChem (CID 883995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).