C17H18N4O3S — CID 8840374
2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(4-methyl-1,3-benzothiazol-2-yl)acetamide (PubChem CID 8840374) has the molecular formula C17H18N4O3S and a molecular weight of 358.42 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(4-methyl-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(4-methyl-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 8840374 |
| Molecular Formula | C17H18N4O3S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(4-methyl-1,3-benzothiazol-2-yl)acetamide |
| SMILES | Cc1cccc2sc(NC(=O)CN3C(=O)NC4(CCCC4)C3=O)nc12 |
| InChI | InChI=1S/C17H18N4O3S/c1-10-5-4-6-11-13(10)19-15(25-11)18-12(22)9-21-14(23)17(20-16(21)24)7-2-3-8-17/h4-6H,2-3,7-9H2,1H3,(H,20,24)(H,18,19,22) |
| InChIKey | HNHYRXOTLQXGHY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|