C11H12F3N3O4S — CID 8841063
2-oxo-N-propan-2-yl-2-[2-(2,3,4-trifluorophenyl)sulfonylhydrazinyl]acetamide (PubChem CID 8841063) has the molecular formula C11H12F3N3O4S and a molecular weight of 339.30 g/mol. Its IUPAC name is 2-oxo-N-propan-2-yl-2-[2-(2,3,4-trifluorophenyl)sulfonylhydrazinyl]acetamide.
| Compound Name | 2-oxo-N-propan-2-yl-2-[2-(2,3,4-trifluorophenyl)sulfonylhydrazinyl]acetamide |
|---|---|
| PubChem CID | 8841063 |
| Molecular Formula | C11H12F3N3O4S |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 2-oxo-N-propan-2-yl-2-[2-(2,3,4-trifluorophenyl)sulfonylhydrazinyl]acetamide |
| SMILES | CC(C)NC(=O)C(=O)NNS(=O)(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H12F3N3O4S/c1-5(2)15-10(18)11(19)16-17-22(20,21)7-4-3-6(12)8(13)9(7)14/h3-5,17H,1-2H3,(H,15,18)(H,16,19) |
| InChIKey | JIEHMUGBNJQEAH-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|