About 2-[2-(2,6-difluorophenyl)sulfonylhydrazinyl]-2-oxo-N-propan-2-ylacetamide
2-[2-(2,6-difluorophenyl)sulfonylhydrazinyl]-2-oxo-N-propan-2-ylacetamide (PubChem CID 8841069) has the molecular formula C11H13F2N3O4S
and a molecular weight of 321.31 g/mol. Its IUPAC name is 2-[2-(2,6-difluorophenyl)sulfonylhydrazinyl]-2-oxo-N-propan-2-ylacetamide.
Molecular Properties
| Compound Name | 2-[2-(2,6-difluorophenyl)sulfonylhydrazinyl]-2-oxo-N-propan-2-ylacetamide |
| PubChem CID | 8841069 |
| Molecular Formula | C11H13F2N3O4S |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 2-[2-(2,6-difluorophenyl)sulfonylhydrazinyl]-2-oxo-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)C(=O)NNS(=O)(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C11H13F2N3O4S/c1-6(2)14-10(17)11(18)15-16-21(19,20)9-7(12)4-3-5-8(9)13/h3-6,16H,1-2H3,(H,14,17)(H,15,18) |
| InChIKey | XDOOEDHVOFHROP-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,6-difluorophenyl)sulfonylhydrazinyl]-2-oxo-N-propan-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,6-difluorophenyl)sulfonylhydrazinyl]-2-oxo-N-propan-2-ylacetamide?
The IUPAC name of 2-[2-(2,6-difluorophenyl)sulfonylhydrazinyl]-2-oxo-N-propan-2-ylacetamide (CID 8841069) is 2-[2-(2,6-difluorophenyl)sulfonylhydrazinyl]-2-oxo-N-propan-2-ylacetamide.
What is the SMILES notation for 2-[2-(2,6-difluorophenyl)sulfonylhydrazinyl]-2-oxo-N-propan-2-ylacetamide?
The canonical SMILES for 2-[2-(2,6-difluorophenyl)sulfonylhydrazinyl]-2-oxo-N-propan-2-ylacetamide is CC(C)NC(=O)C(=O)NNS(=O)(=O)c1c(F)cccc1F.
What is the InChIKey of 2-[2-(2,6-difluorophenyl)sulfonylhydrazinyl]-2-oxo-N-propan-2-ylacetamide?
The InChIKey is XDOOEDHVOFHROP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2N3O4S/c1-6(2)14-10(17)11(18)15-16-21(19,20)9-7(12)4-3-5-8(9)13/h3-6,16H,1-2H3,(H,14,17)(H,15,18).
What are the key properties of 2-[2-(2,6-difluorophenyl)sulfonylhydrazinyl]-2-oxo-N-propan-2-ylacetamide?
2-[2-(2,6-difluorophenyl)sulfonylhydrazinyl]-2-oxo-N-propan-2-ylacetamide has a molecular weight of 321.31 g/mol, XLogP of -0.20, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,6-difluorophenyl)sulfonylhydrazinyl]-2-oxo-N-propan-2-ylacetamide is sourced from PubChem (CID 8841069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).