C17H12FNO2 — CID 884117
2-(2-fluorophenyl)-4-(3-methylphenyl)-1,3-oxazin-6-one (PubChem CID 884117) has the molecular formula C17H12FNO2 and a molecular weight of 281.29 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-4-(3-methylphenyl)-1,3-oxazin-6-one.
| Compound Name | 2-(2-fluorophenyl)-4-(3-methylphenyl)-1,3-oxazin-6-one |
|---|---|
| PubChem CID | 884117 |
| Molecular Formula | C17H12FNO2 |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2-(2-fluorophenyl)-4-(3-methylphenyl)-1,3-oxazin-6-one |
| SMILES | Cc1cccc(-c2cc(=O)oc(-c3ccccc3F)n2)c1 |
| InChI | InChI=1S/C17H12FNO2/c1-11-5-4-6-12(9-11)15-10-16(20)21-17(19-15)13-7-2-3-8-14(13)18/h2-10H,1H3 |
| InChIKey | GYJXYRZAGQYNHT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |