C11H12FN3O4S — CID 8841180
N-cyclopropyl-2-[2-(4-fluorophenyl)sulfonylhydrazinyl]-2-oxoacetamide (PubChem CID 8841180) has the molecular formula C11H12FN3O4S and a molecular weight of 301.30 g/mol. Its IUPAC name is N-cyclopropyl-2-[2-(4-fluorophenyl)sulfonylhydrazinyl]-2-oxoacetamide.
| Compound Name | N-cyclopropyl-2-[2-(4-fluorophenyl)sulfonylhydrazinyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 8841180 |
| Molecular Formula | C11H12FN3O4S |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | N-cyclopropyl-2-[2-(4-fluorophenyl)sulfonylhydrazinyl]-2-oxoacetamide |
| SMILES | C1CC1NC(=O)C(=O)NNS(=O)(=O)C2=CC=C(C=C2)F |
| InChI | InChI=1S/C11H12FN3O4S/c12-7-1-5-9(6-2-7)20(18,19)15-14-11(17)10(16)13-8-3-4-8/h1-2,5-6,8,15H,3-4H2,(H,13,16)(H,14,17) |
| InChIKey | QCUVPUBJNDPGJX-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | 478 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|