C8H18N2O3S — CID 884474
(2S,6R)-N,N,2,6-tetramethylmorpholine-4-sulfonamide (PubChem CID 884474) has the molecular formula C8H18N2O3S and a molecular weight of 222.31 g/mol. Its IUPAC name is (2S,6R)-N,N,2,6-tetramethylmorpholine-4-sulfonamide.
| Compound Name | (2S,6R)-N,N,2,6-tetramethylmorpholine-4-sulfonamide |
|---|---|
| PubChem CID | 884474 |
| Molecular Formula | C8H18N2O3S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | (2S,6R)-N,N,2,6-tetramethylmorpholine-4-sulfonamide |
| SMILES | C[C@@H]1CN(S(=O)(=O)N(C)C)C[C@H](C)O1 |
| InChI | InChI=1S/C8H18N2O3S/c1-7-5-10(6-8(2)13-7)14(11,12)9(3)4/h7-8H,5-6H2,1-4H3/t7-,8+ |
| InChIKey | LCYHUIFOKKLFCK-OCAPTIKFSA-N |
| XLogP | -0.10 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |