About 2-hydroxyhexanedial
2-hydroxyhexanedial (PubChem CID 8845) has the molecular formula C6H10O3
and a molecular weight of 130.14 g/mol. Its IUPAC name is 2-hydroxyhexanedial.
Molecular Properties
| Compound Name | 2-hydroxyhexanedial |
| PubChem CID | 8845 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | 2-hydroxyhexanedial |
| SMILES | O=CCCCC(O)C=O |
| InChI | InChI=1S/C6H10O3/c7-4-2-1-3-6(9)5-8/h4-6,9H,1-3H2 |
| InChIKey | WWMIMRADNBGDHP-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyhexanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyhexanedial?
The IUPAC name of 2-hydroxyhexanedial (CID 8845) is 2-hydroxyhexanedial.
What is the SMILES notation for 2-hydroxyhexanedial?
The canonical SMILES for 2-hydroxyhexanedial is O=CCCCC(O)C=O.
What is the InChIKey of 2-hydroxyhexanedial?
The InChIKey is WWMIMRADNBGDHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3/c7-4-2-1-3-6(9)5-8/h4-6,9H,1-3H2.
What are the key properties of 2-hydroxyhexanedial?
2-hydroxyhexanedial has a molecular weight of 130.14 g/mol, XLogP of -0.08, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyhexanedial is sourced from PubChem (CID 8845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).