C21H25NO6 — CID 8847228
[(2R)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] (2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate (PubChem CID 8847228) has the molecular formula C21H25NO6 and a molecular weight of 387.43 g/mol. Its IUPAC name is [(2R)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] (2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate.
| Compound Name | [(2R)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] (2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 8847228 |
| Molecular Formula | C21H25NO6 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | [(2R)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] (2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
| SMILES | COc1ccc(C(=O)[C@@H](C)OC(=O)[C@H](C)N2C(=O)[C@H]3CCCC[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C21H25NO6/c1-12(22-19(24)16-6-4-5-7-17(16)20(22)25)21(26)28-13(2)18(23)14-8-10-15(27-3)11-9-14/h8-13,16-17H,4-7H2,1-3H3/t12-,13+,16-,17+/m0/s1 |
| InChIKey | QAZXGIAGMDJRQP-UWWPHRKUSA-N |
| XLogP | 2.37 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|