About 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)-2-methoxybenzamide
5-chloro-N-(4,6-dimethylpyrimidin-2-yl)-2-methoxybenzamide (PubChem CID 884726) has the molecular formula C14H14ClN3O2
and a molecular weight of 291.74 g/mol. Its IUPAC name is 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)-2-methoxybenzamide.
Molecular Properties
| Compound Name | 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)-2-methoxybenzamide |
| PubChem CID | 884726 |
| Molecular Formula | C14H14ClN3O2 |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)Nc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C14H14ClN3O2/c1-8-6-9(2)17-14(16-8)18-13(19)11-7-10(15)4-5-12(11)20-3/h4-7H,1-3H3,(H,16,17,18,19) |
| InChIKey | NAVBDZFXQFMHTF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)-2-methoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)-2-methoxybenzamide?
The IUPAC name of 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)-2-methoxybenzamide (CID 884726) is 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)-2-methoxybenzamide.
What is the SMILES notation for 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)-2-methoxybenzamide?
The canonical SMILES for 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)-2-methoxybenzamide is COc1ccc(Cl)cc1C(=O)Nc1nc(C)cc(C)n1.
What is the InChIKey of 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)-2-methoxybenzamide?
The InChIKey is NAVBDZFXQFMHTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClN3O2/c1-8-6-9(2)17-14(16-8)18-13(19)11-7-10(15)4-5-12(11)20-3/h4-7H,1-3H3,(H,16,17,18,19).
What are the key properties of 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)-2-methoxybenzamide?
5-chloro-N-(4,6-dimethylpyrimidin-2-yl)-2-methoxybenzamide has a molecular weight of 291.74 g/mol, XLogP of 3.01, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-(4,6-dimethylpyrimidin-2-yl)-2-methoxybenzamide is sourced from PubChem (CID 884726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).