C21H25FN2O5 — CID 8847542
[2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl] (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate (PubChem CID 8847542) has the molecular formula C21H25FN2O5 and a molecular weight of 404.44 g/mol. Its IUPAC name is [2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl] (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate.
| Compound Name | [2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl] (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 8847542 |
| Molecular Formula | C21H25FN2O5 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | [2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl] (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
| SMILES | C[C@@H](C(=O)OCC(=O)NCCc1ccccc1F)N1C(=O)[C@H]2CCCC[C@@H]2C1=O |
| InChI | InChI=1S/C21H25FN2O5/c1-13(24-19(26)15-7-3-4-8-16(15)20(24)27)21(28)29-12-18(25)23-11-10-14-6-2-5-9-17(14)22/h2,5-6,9,13,15-16H,3-4,7-8,10-12H2,1H3,(H,23,25)/t13-,15-,16-/m0/s1 |
| InChIKey | JJHSYVLMPUZULM-BPUTZDHNSA-N |
| XLogP | 1.59 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|