C17H22N8S2 — CID 88500280
2-[3-[[3-(1,3-thiazol-4-ylmethyl)imidazo[4,5-b]pyridin-2-yl]amino]pyrrolidin-1-yl]ethylthiourea (PubChem CID 88500280) has the molecular formula C17H22N8S2 and a molecular weight of 402.55 g/mol. Its IUPAC name is 2-[3-[[3-(1,3-thiazol-4-ylmethyl)imidazo[4,5-b]pyridin-2-yl]amino]pyrrolidin-1-yl]ethylthiourea.
| Compound Name | 2-[3-[[3-(1,3-thiazol-4-ylmethyl)imidazo[4,5-b]pyridin-2-yl]amino]pyrrolidin-1-yl]ethylthiourea |
|---|---|
| PubChem CID | 88500280 |
| Molecular Formula | C17H22N8S2 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 2-[3-[[3-(1,3-thiazol-4-ylmethyl)imidazo[4,5-b]pyridin-2-yl]amino]pyrrolidin-1-yl]ethylthiourea |
| SMILES | NC(=S)NCCN1CCC(Nc2nc3cccnc3n2Cc2cscn2)C1 |
| InChI | InChI=1S/C17H22N8S2/c18-16(26)20-5-7-24-6-3-12(8-24)22-17-23-14-2-1-4-19-15(14)25(17)9-13-10-27-11-21-13/h1-2,4,10-12H,3,5-9H2,(H,22,23)(H3,18,20,26) |
| InChIKey | MVCWLZISJIKIJA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 96.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|