C13H22O5 — CID 88500562
(5E)-4,7,8-trimethoxy-2-methyl-2,3,4,7,8,9-hexahydrooxecin-10-one (PubChem CID 88500562) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is (5E)-4,7,8-trimethoxy-2-methyl-2,3,4,7,8,9-hexahydrooxecin-10-one.
| Compound Name | (5E)-4,7,8-trimethoxy-2-methyl-2,3,4,7,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 88500562 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | (5E)-4,7,8-trimethoxy-2-methyl-2,3,4,7,8,9-hexahydrooxecin-10-one |
| SMILES | COC1/C=C/C(OC)C(OC)CC(=O)OC(C)C1 |
| InChI | InChI=1S/C13H22O5/c1-9-7-10(15-2)5-6-11(16-3)12(17-4)8-13(14)18-9/h5-6,9-12H,7-8H2,1-4H3/b6-5+ |
| InChIKey | CVNWBVIZWOJQDN-AATRIKPKSA-N |
| XLogP | 1.31 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|