C21H20F5N3O4S — CID 88501046
propyl 6,8-difluoro-1-methyl-4-oxo-7-[3-[(2,2,2-trifluoroacetyl)amino]pyrrolidin-1-yl]-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylate (PubChem CID 88501046) has the molecular formula C21H20F5N3O4S and a molecular weight of 505.47 g/mol. Its IUPAC name is propyl 6,8-difluoro-1-methyl-4-oxo-7-[3-[(2,2,2-trifluoroacetyl)amino]pyrrolidin-1-yl]-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylate.
| Compound Name | propyl 6,8-difluoro-1-methyl-4-oxo-7-[3-[(2,2,2-trifluoroacetyl)amino]pyrrolidin-1-yl]-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 88501046 |
| Molecular Formula | C21H20F5N3O4S |
| Molecular Weight | 505.47 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | propyl 6,8-difluoro-1-methyl-4-oxo-7-[3-[(2,2,2-trifluoroacetyl)amino]pyrrolidin-1-yl]-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylate |
| SMILES | CCCOC(=O)c1c2n(c3c(F)c(N4CCC(NC(=O)C(F)(F)F)C4)c(F)cc3c1=O)C(C)S2 |
| InChI | InChI=1S/C21H20F5N3O4S/c1-3-6-33-19(31)13-17(30)11-7-12(22)16(14(23)15(11)29-9(2)34-18(13)29)28-5-4-10(8-28)27-20(32)21(24,25)26/h7,9-10H,3-6,8H2,1-2H3,(H,27,32) |
| InChIKey | HTARBVITJFPJIP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |