About 4,4-dinitro-2-phenylcyclohexa-1,5-dien-1-ol
4,4-dinitro-2-phenylcyclohexa-1,5-dien-1-ol (PubChem CID 88502403) has the molecular formula C12H10N2O5
and a molecular weight of 262.22 g/mol. Its IUPAC name is 4,4-dinitro-2-phenylcyclohexa-1,5-dien-1-ol.
Molecular Properties
| Compound Name | 4,4-dinitro-2-phenylcyclohexa-1,5-dien-1-ol |
| PubChem CID | 88502403 |
| Molecular Formula | C12H10N2O5 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 4,4-dinitro-2-phenylcyclohexa-1,5-dien-1-ol |
| SMILES | O=[N+]([O-])C1([N+](=O)[O-])C=CC(O)=C(c2ccccc2)C1 |
| InChI | InChI=1S/C12H10N2O5/c15-11-6-7-12(13(16)17,14(18)19)8-10(11)9-4-2-1-3-5-9/h1-7,15H,8H2 |
| InChIKey | ZVKNWKGWWVXHCU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dinitro-2-phenylcyclohexa-1,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dinitro-2-phenylcyclohexa-1,5-dien-1-ol?
The IUPAC name of 4,4-dinitro-2-phenylcyclohexa-1,5-dien-1-ol (CID 88502403) is 4,4-dinitro-2-phenylcyclohexa-1,5-dien-1-ol.
What is the SMILES notation for 4,4-dinitro-2-phenylcyclohexa-1,5-dien-1-ol?
The canonical SMILES for 4,4-dinitro-2-phenylcyclohexa-1,5-dien-1-ol is O=[N+]([O-])C1([N+](=O)[O-])C=CC(O)=C(c2ccccc2)C1.
What is the InChIKey of 4,4-dinitro-2-phenylcyclohexa-1,5-dien-1-ol?
The InChIKey is ZVKNWKGWWVXHCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O5/c15-11-6-7-12(13(16)17,14(18)19)8-10(11)9-4-2-1-3-5-9/h1-7,15H,8H2.
What are the key properties of 4,4-dinitro-2-phenylcyclohexa-1,5-dien-1-ol?
4,4-dinitro-2-phenylcyclohexa-1,5-dien-1-ol has a molecular weight of 262.22 g/mol, XLogP of 2.17, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dinitro-2-phenylcyclohexa-1,5-dien-1-ol is sourced from PubChem (CID 88502403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).