About 2-(4-bromophenyl)-N-(4,6-dimethylpyrimidin-2-yl)acetamide
2-(4-bromophenyl)-N-(4,6-dimethylpyrimidin-2-yl)acetamide (PubChem CID 885027) has the molecular formula C14H14BrN3O
and a molecular weight of 320.19 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-(4,6-dimethylpyrimidin-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-N-(4,6-dimethylpyrimidin-2-yl)acetamide |
| PubChem CID | 885027 |
| Molecular Formula | C14H14BrN3O |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 2-(4-bromophenyl)-N-(4,6-dimethylpyrimidin-2-yl)acetamide |
| SMILES | Cc1cc(C)nc(NC(=O)Cc2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C14H14BrN3O/c1-9-7-10(2)17-14(16-9)18-13(19)8-11-3-5-12(15)6-4-11/h3-7H,8H2,1-2H3,(H,16,17,18,19) |
| InChIKey | XRPGLKBHEKUWRQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-bromophenyl)-N-(4,6-dimethylpyrimidin-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-N-(4,6-dimethylpyrimidin-2-yl)acetamide?
The IUPAC name of 2-(4-bromophenyl)-N-(4,6-dimethylpyrimidin-2-yl)acetamide (CID 885027) is 2-(4-bromophenyl)-N-(4,6-dimethylpyrimidin-2-yl)acetamide.
What is the SMILES notation for 2-(4-bromophenyl)-N-(4,6-dimethylpyrimidin-2-yl)acetamide?
The canonical SMILES for 2-(4-bromophenyl)-N-(4,6-dimethylpyrimidin-2-yl)acetamide is Cc1cc(C)nc(NC(=O)Cc2ccc(Br)cc2)n1.
What is the InChIKey of 2-(4-bromophenyl)-N-(4,6-dimethylpyrimidin-2-yl)acetamide?
The InChIKey is XRPGLKBHEKUWRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BrN3O/c1-9-7-10(2)17-14(16-9)18-13(19)8-11-3-5-12(15)6-4-11/h3-7H,8H2,1-2H3,(H,16,17,18,19).
What are the key properties of 2-(4-bromophenyl)-N-(4,6-dimethylpyrimidin-2-yl)acetamide?
2-(4-bromophenyl)-N-(4,6-dimethylpyrimidin-2-yl)acetamide has a molecular weight of 320.19 g/mol, XLogP of 3.04, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-N-(4,6-dimethylpyrimidin-2-yl)acetamide is sourced from PubChem (CID 885027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).