About ethyl 2-[3-bromo-2,6-dichloro-4-(trifluoromethyl)phenyl]-1H-imidazole-5-carboxylate
ethyl 2-[3-bromo-2,6-dichloro-4-(trifluoromethyl)phenyl]-1H-imidazole-5-carboxylate (PubChem CID 88502944) has the molecular formula C13H8BrCl2F3N2O2
and a molecular weight of 432.02 g/mol. Its IUPAC name is ethyl 2-[3-bromo-2,6-dichloro-4-(trifluoromethyl)phenyl]-1H-imidazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[3-bromo-2,6-dichloro-4-(trifluoromethyl)phenyl]-1H-imidazole-5-carboxylate |
| PubChem CID | 88502944 |
| Molecular Formula | C13H8BrCl2F3N2O2 |
| Molecular Weight | 432.02 g/mol |
| Exact Mass | 429.91 |
| IUPAC Name | ethyl 2-[3-bromo-2,6-dichloro-4-(trifluoromethyl)phenyl]-1H-imidazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(-c2c(Cl)cc(C(F)(F)F)c(Br)c2Cl)[nH]1 |
| InChI | InChI=1S/C13H8BrCl2F3N2O2/c1-2-23-12(22)7-4-20-11(21-7)8-6(15)3-5(13(17,18)19)9(14)10(8)16/h3-4H,2H2,1H3,(H,20,21) |
| InChIKey | GUKQWDDQXRPJSH-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.02 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[3-bromo-2,6-dichloro-4-(trifluoromethyl)phenyl]-1H-imidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[3-bromo-2,6-dichloro-4-(trifluoromethyl)phenyl]-1H-imidazole-5-carboxylate?
The IUPAC name of ethyl 2-[3-bromo-2,6-dichloro-4-(trifluoromethyl)phenyl]-1H-imidazole-5-carboxylate (CID 88502944) is ethyl 2-[3-bromo-2,6-dichloro-4-(trifluoromethyl)phenyl]-1H-imidazole-5-carboxylate.
What is the SMILES notation for ethyl 2-[3-bromo-2,6-dichloro-4-(trifluoromethyl)phenyl]-1H-imidazole-5-carboxylate?
The canonical SMILES for ethyl 2-[3-bromo-2,6-dichloro-4-(trifluoromethyl)phenyl]-1H-imidazole-5-carboxylate is CCOC(=O)c1cnc(-c2c(Cl)cc(C(F)(F)F)c(Br)c2Cl)[nH]1.
What is the InChIKey of ethyl 2-[3-bromo-2,6-dichloro-4-(trifluoromethyl)phenyl]-1H-imidazole-5-carboxylate?
The InChIKey is GUKQWDDQXRPJSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8BrCl2F3N2O2/c1-2-23-12(22)7-4-20-11(21-7)8-6(15)3-5(13(17,18)19)9(14)10(8)16/h3-4H,2H2,1H3,(H,20,21).
What are the key properties of ethyl 2-[3-bromo-2,6-dichloro-4-(trifluoromethyl)phenyl]-1H-imidazole-5-carboxylate?
ethyl 2-[3-bromo-2,6-dichloro-4-(trifluoromethyl)phenyl]-1H-imidazole-5-carboxylate has a molecular weight of 432.02 g/mol, XLogP of 5.34, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[3-bromo-2,6-dichloro-4-(trifluoromethyl)phenyl]-1H-imidazole-5-carboxylate is sourced from PubChem (CID 88502944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).