C35H18Br10F6O5 — CID 88503138
4-[1,1-bis(3,5-dibromo-4-hydroxyphenyl)ethyl]-2,6-dibromophenol;2,3,5,6-tetrabromo-4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol (PubChem CID 88503138) has the molecular formula C35H18Br10F6O5 and a molecular weight of 1431.55 g/mol. Its IUPAC name is 4-[1,1-bis(3,5-dibromo-4-hydroxyphenyl)ethyl]-2,6-dibromophenol;2,3,5,6-tetrabromo-4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol.
| Compound Name | 4-[1,1-bis(3,5-dibromo-4-hydroxyphenyl)ethyl]-2,6-dibromophenol;2,3,5,6-tetrabromo-4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol |
|---|---|
| PubChem CID | 88503138 |
| Molecular Formula | C35H18Br10F6O5 |
| Molecular Weight | 1431.55 g/mol |
| Exact Mass | 1421.29 |
| IUPAC Name | 4-[1,1-bis(3,5-dibromo-4-hydroxyphenyl)ethyl]-2,6-dibromophenol;2,3,5,6-tetrabromo-4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol |
| SMILES | CC(c1cc(Br)c(O)c(Br)c1)(c1cc(Br)c(O)c(Br)c1)c1cc(Br)c(O)c(Br)c1.Oc1ccc(C(c2c(Br)c(Br)c(O)c(Br)c2Br)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H12Br6O3.C15H6Br4F6O2/c1-20(8-2-11(21)17(27)12(22)3-8,9-4-13(23)18(28)14(24)5-9)10-6-15(25)19(29)16(26)7-10;16-8-7(9(17)11(19)12(27)10(8)18)13(14(20,21)22,15(23,24)25)5-1-3-6(26)4-2-5/h2-7,27-29H,1H3;1-4,26-27H |
| InChIKey | MIWGLBVPGKGJGL-UHFFFAOYSA-N |
| XLogP | 16.29 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1431.55 |
| LogP ≤ 5 | 16.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|