About 2,5-dimethylhex-5-ene-1,1-diol
2,5-dimethylhex-5-ene-1,1-diol (PubChem CID 88503199) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is 2,5-dimethylhex-5-ene-1,1-diol.
Molecular Properties
| Compound Name | 2,5-dimethylhex-5-ene-1,1-diol |
| PubChem CID | 88503199 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | 2,5-dimethylhex-5-ene-1,1-diol |
| SMILES | C=C(C)CCC(C)C(O)O |
| InChI | InChI=1S/C8H16O2/c1-6(2)4-5-7(3)8(9)10/h7-10H,1,4-5H2,2-3H3 |
| InChIKey | VNLOYRCRTMDPIV-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethylhex-5-ene-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethylhex-5-ene-1,1-diol?
The IUPAC name of 2,5-dimethylhex-5-ene-1,1-diol (CID 88503199) is 2,5-dimethylhex-5-ene-1,1-diol.
What is the SMILES notation for 2,5-dimethylhex-5-ene-1,1-diol?
The canonical SMILES for 2,5-dimethylhex-5-ene-1,1-diol is C=C(C)CCC(C)C(O)O.
What is the InChIKey of 2,5-dimethylhex-5-ene-1,1-diol?
The InChIKey is VNLOYRCRTMDPIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2/c1-6(2)4-5-7(3)8(9)10/h7-10H,1,4-5H2,2-3H3.
What are the key properties of 2,5-dimethylhex-5-ene-1,1-diol?
2,5-dimethylhex-5-ene-1,1-diol has a molecular weight of 144.21 g/mol, XLogP of 1.29, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethylhex-5-ene-1,1-diol is sourced from PubChem (CID 88503199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).