C66H88N4O6Si6 — CID 88503351
3-[[[3-aminopropyl(diphenyl)silyl]oxy-dimethylsilyl]oxy-diphenylsilyl]propan-1-amine;bis[4-aminobutyl(diphenyl)silyl] dimethyl silicate (PubChem CID 88503351) has the molecular formula C66H88N4O6Si6 and a molecular weight of 1201.97 g/mol. Its IUPAC name is 3-[[[3-aminopropyl(diphenyl)silyl]oxy-dimethylsilyl]oxy-diphenylsilyl]propan-1-amine;bis[4-aminobutyl(diphenyl)silyl] dimethyl silicate.
| Compound Name | 3-[[[3-aminopropyl(diphenyl)silyl]oxy-dimethylsilyl]oxy-diphenylsilyl]propan-1-amine;bis[4-aminobutyl(diphenyl)silyl] dimethyl silicate |
|---|---|
| PubChem CID | 88503351 |
| Molecular Formula | C66H88N4O6Si6 |
| Molecular Weight | 1201.97 g/mol |
| Exact Mass | 1200.53 |
| IUPAC Name | 3-[[[3-aminopropyl(diphenyl)silyl]oxy-dimethylsilyl]oxy-diphenylsilyl]propan-1-amine;bis[4-aminobutyl(diphenyl)silyl] dimethyl silicate |
| SMILES | CO[Si](OC)(O[Si](CCCCN)(c1ccccc1)c1ccccc1)O[Si](CCCCN)(c1ccccc1)c1ccccc1.C[Si](C)(O[Si](CCCN)(c1ccccc1)c1ccccc1)O[Si](CCCN)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H46N2O4Si3.C32H42N2O2Si3/c1-37-43(38-2,39-41(29-17-15-27-35,31-19-7-3-8-20-31)32-21-9-4-10-22-32)40-42(30-18-16-28-36,33-23-11-5-12-24-33)34-25-13-6-14-26-34;1-37(2,35-38(27-15-25-33,29-17-7-3-8-18-29)30-19-9-4-10-20-30)36-39(28-16-26-34,31-21-11-5-12-22-31)32-23-13-6-14-24-32/h3-14,19-26H,15-18,27-30,35-36H2,1-2H3;3-14,17-24H,15-16,25-28,33-34H2,1-2H3 |
| InChIKey | GYMGFZLWAHELKZ-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 159.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1201.97 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|