About 8-fluoro-10-methyl-5,6-dihydroacridin-1-one
8-fluoro-10-methyl-5,6-dihydroacridin-1-one (PubChem CID 88503580) has the molecular formula C14H12FNO
and a molecular weight of 229.25 g/mol. Its IUPAC name is 8-fluoro-10-methyl-5,6-dihydroacridin-1-one.
Molecular Properties
| Compound Name | 8-fluoro-10-methyl-5,6-dihydroacridin-1-one |
| PubChem CID | 88503580 |
| Molecular Formula | C14H12FNO |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 8-fluoro-10-methyl-5,6-dihydroacridin-1-one |
| SMILES | Cn1c2cccc(=O)c-2cc2c1CCC=C2F |
| InChI | InChI=1S/C14H12FNO/c1-16-12-5-2-4-11(15)9(12)8-10-13(16)6-3-7-14(10)17/h3-4,6-8H,2,5H2,1H3 |
| InChIKey | UMMNOFRHDMUYQS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-fluoro-10-methyl-5,6-dihydroacridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-10-methyl-5,6-dihydroacridin-1-one?
The IUPAC name of 8-fluoro-10-methyl-5,6-dihydroacridin-1-one (CID 88503580) is 8-fluoro-10-methyl-5,6-dihydroacridin-1-one.
What is the SMILES notation for 8-fluoro-10-methyl-5,6-dihydroacridin-1-one?
The canonical SMILES for 8-fluoro-10-methyl-5,6-dihydroacridin-1-one is Cn1c2cccc(=O)c-2cc2c1CCC=C2F.
What is the InChIKey of 8-fluoro-10-methyl-5,6-dihydroacridin-1-one?
The InChIKey is UMMNOFRHDMUYQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12FNO/c1-16-12-5-2-4-11(15)9(12)8-10-13(16)6-3-7-14(10)17/h3-4,6-8H,2,5H2,1H3.
What are the key properties of 8-fluoro-10-methyl-5,6-dihydroacridin-1-one?
8-fluoro-10-methyl-5,6-dihydroacridin-1-one has a molecular weight of 229.25 g/mol, XLogP of 2.75, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-10-methyl-5,6-dihydroacridin-1-one is sourced from PubChem (CID 88503580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).