C32H28N4O4 — CID 88503848
diphenyl benzene-1,3-dicarboxylate;5-phenylbenzene-1,2,3,4-tetramine (PubChem CID 88503848) has the molecular formula C32H28N4O4 and a molecular weight of 532.60 g/mol. Its IUPAC name is diphenyl benzene-1,3-dicarboxylate;5-phenylbenzene-1,2,3,4-tetramine.
| Compound Name | diphenyl benzene-1,3-dicarboxylate;5-phenylbenzene-1,2,3,4-tetramine |
|---|---|
| PubChem CID | 88503848 |
| Molecular Formula | C32H28N4O4 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | diphenyl benzene-1,3-dicarboxylate;5-phenylbenzene-1,2,3,4-tetramine |
| SMILES | Nc1cc(-c2ccccc2)c(N)c(N)c1N.O=C(Oc1ccccc1)c1cccc(C(=O)Oc2ccccc2)c1 |
| InChI | InChI=1S/C20H14O4.C12H14N4/c21-19(23-17-10-3-1-4-11-17)15-8-7-9-16(14-15)20(22)24-18-12-5-2-6-13-18;13-9-6-8(7-4-2-1-3-5-7)10(14)12(16)11(9)15/h1-14H;1-6H,13-16H2 |
| InChIKey | LYCLMNVXCWDJDQ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 156.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|