C18H38NO7P — CID 88503852
[(2S)-2,3-dihydroxy-4-oxotridecyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 88503852) has the molecular formula C18H38NO7P and a molecular weight of 411.48 g/mol. Its IUPAC name is [(2S)-2,3-dihydroxy-4-oxotridecyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2S)-2,3-dihydroxy-4-oxotridecyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 88503852 |
| Molecular Formula | C18H38NO7P |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | [(2S)-2,3-dihydroxy-4-oxotridecyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCCCCC(=O)C(O)[C@@H](O)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C18H38NO7P/c1-5-6-7-8-9-10-11-12-16(20)18(22)17(21)15-26-27(23,24)25-14-13-19(2,3)4/h17-18,21-22H,5-15H2,1-4H3/t17-,18?/m0/s1 |
| InChIKey | TWNRKOSINASNNR-ZENAZSQFSA-N |
| XLogP | 1.63 |
| TPSA | 116.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|