C15H29BrNO8PS — CID 88504000
[(3R)-3-aminobutyl] methyl hydrogen phosphate;bromo-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid (PubChem CID 88504000) has the molecular formula C15H29BrNO8PS and a molecular weight of 494.34 g/mol. Its IUPAC name is [(3R)-3-aminobutyl] methyl hydrogen phosphate;bromo-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid.
| Compound Name | [(3R)-3-aminobutyl] methyl hydrogen phosphate;bromo-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid |
|---|---|
| PubChem CID | 88504000 |
| Molecular Formula | C15H29BrNO8PS |
| Molecular Weight | 494.34 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | [(3R)-3-aminobutyl] methyl hydrogen phosphate;bromo-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid |
| SMILES | CC1(C)C2CCC1(C(Br)S(=O)(=O)O)C(=O)C2.COP(=O)(O)OCC[C@@H](C)N |
| InChI | InChI=1S/C10H15BrO4S.C5H14NO4P/c1-9(2)6-3-4-10(9,7(12)5-6)8(11)16(13,14)15;1-5(6)3-4-10-11(7,8)9-2/h6,8H,3-5H2,1-2H3,(H,13,14,15);5H,3-4,6H2,1-2H3,(H,7,8)/t;5-/m.1/s1 |
| InChIKey | PNTZRUORJOSQTD-QDXATWJZSA-N |
| XLogP | 2.48 |
| TPSA | 153.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|