1-fluoro-2,5-dimethylcyclohexa-2,4-diene-1-carbonyl chloride

C9H10ClFO — CID 88504228

IUPAC1-fluoro-2,5-dimethylcyclohexa-2,4-diene-1-carbonyl chloride
SMILESCC1=CC=C(C)C(F)(C(=O)Cl)C1
InChIInChI=1S/C9H10ClFO/c1-6-3-4-7(2)9(11,5-6)8(10)12/h3-4H,5H2,1-2H3
InChIKeyZZSUFBYWWBSCHP-UHFFFAOYSA-N
MW188.63 g/mol
LogP2.76
Rot. Bonds1

About 1-fluoro-2,5-dimethylcyclohexa-2,4-diene-1-carbonyl chloride

1-fluoro-2,5-dimethylcyclohexa-2,4-diene-1-carbonyl chloride (PubChem CID 88504228) has the molecular formula C9H10ClFO and a molecular weight of 188.63 g/mol. Its IUPAC name is 1-fluoro-2,5-dimethylcyclohexa-2,4-diene-1-carbonyl chloride.

Molecular Properties

Compound Name1-fluoro-2,5-dimethylcyclohexa-2,4-diene-1-carbonyl chloride
PubChem CID88504228
Molecular FormulaC9H10ClFO
Molecular Weight188.63 g/mol
Exact Mass188.04
IUPAC Name1-fluoro-2,5-dimethylcyclohexa-2,4-diene-1-carbonyl chloride
SMILESCC1=CC=C(C)C(F)(C(=O)Cl)C1
InChIInChI=1S/C9H10ClFO/c1-6-3-4-7(2)9(11,5-6)8(10)12/h3-4H,5H2,1-2H3
InChIKeyZZSUFBYWWBSCHP-UHFFFAOYSA-N
XLogP2.76
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.63
LogP ≤ 52.76
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 1-fluoro-2,5-dimethylcyclohexa-2,4-diene-1-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-fluoro-2,5-dimethylcyclohexa-2,4-diene-1-carbonyl chloride?
The IUPAC name of 1-fluoro-2,5-dimethylcyclohexa-2,4-diene-1-carbonyl chloride (CID 88504228) is 1-fluoro-2,5-dimethylcyclohexa-2,4-diene-1-carbonyl chloride.
What is the SMILES notation for 1-fluoro-2,5-dimethylcyclohexa-2,4-diene-1-carbonyl chloride?
The canonical SMILES for 1-fluoro-2,5-dimethylcyclohexa-2,4-diene-1-carbonyl chloride is CC1=CC=C(C)C(F)(C(=O)Cl)C1.
What is the InChIKey of 1-fluoro-2,5-dimethylcyclohexa-2,4-diene-1-carbonyl chloride?
The InChIKey is ZZSUFBYWWBSCHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClFO/c1-6-3-4-7(2)9(11,5-6)8(10)12/h3-4H,5H2,1-2H3.
What are the key properties of 1-fluoro-2,5-dimethylcyclohexa-2,4-diene-1-carbonyl chloride?
1-fluoro-2,5-dimethylcyclohexa-2,4-diene-1-carbonyl chloride has a molecular weight of 188.63 g/mol, XLogP of 2.76, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-2,5-dimethylcyclohexa-2,4-diene-1-carbonyl chloride is sourced from PubChem (CID 88504228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).