About 3-[(3S,4R)-4-ethyl-4-hydroxypiperidin-3-yl]prop-1-en-1-one
3-[(3S,4R)-4-ethyl-4-hydroxypiperidin-3-yl]prop-1-en-1-one (PubChem CID 88504629) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is 3-[(3S,4R)-4-ethyl-4-hydroxypiperidin-3-yl]prop-1-en-1-one.
Molecular Properties
| Compound Name | 3-[(3S,4R)-4-ethyl-4-hydroxypiperidin-3-yl]prop-1-en-1-one |
| PubChem CID | 88504629 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 3-[(3S,4R)-4-ethyl-4-hydroxypiperidin-3-yl]prop-1-en-1-one |
| SMILES | CC[C@@]1(O)CCNC[C@@H]1CC=C=O |
| InChI | InChI=1S/C10H17NO2/c1-2-10(13)5-6-11-8-9(10)4-3-7-12/h3,9,11,13H,2,4-6,8H2,1H3/t9-,10+/m0/s1 |
| InChIKey | GECKOYBFGRQTIC-VHSXEESVSA-N |
| XLogP | 0.51 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3S,4R)-4-ethyl-4-hydroxypiperidin-3-yl]prop-1-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3S,4R)-4-ethyl-4-hydroxypiperidin-3-yl]prop-1-en-1-one?
The IUPAC name of 3-[(3S,4R)-4-ethyl-4-hydroxypiperidin-3-yl]prop-1-en-1-one (CID 88504629) is 3-[(3S,4R)-4-ethyl-4-hydroxypiperidin-3-yl]prop-1-en-1-one.
What is the SMILES notation for 3-[(3S,4R)-4-ethyl-4-hydroxypiperidin-3-yl]prop-1-en-1-one?
The canonical SMILES for 3-[(3S,4R)-4-ethyl-4-hydroxypiperidin-3-yl]prop-1-en-1-one is CC[C@@]1(O)CCNC[C@@H]1CC=C=O.
What is the InChIKey of 3-[(3S,4R)-4-ethyl-4-hydroxypiperidin-3-yl]prop-1-en-1-one?
The InChIKey is GECKOYBFGRQTIC-VHSXEESVSA-N. The full InChI is InChI=1S/C10H17NO2/c1-2-10(13)5-6-11-8-9(10)4-3-7-12/h3,9,11,13H,2,4-6,8H2,1H3/t9-,10+/m0/s1.
What are the key properties of 3-[(3S,4R)-4-ethyl-4-hydroxypiperidin-3-yl]prop-1-en-1-one?
3-[(3S,4R)-4-ethyl-4-hydroxypiperidin-3-yl]prop-1-en-1-one has a molecular weight of 183.25 g/mol, XLogP of 0.51, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3S,4R)-4-ethyl-4-hydroxypiperidin-3-yl]prop-1-en-1-one is sourced from PubChem (CID 88504629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).