C11H6Cl2F6N2O — CID 88506082
3-amino-N-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4,4,4-trifluorobut-2-enamide (PubChem CID 88506082) has the molecular formula C11H6Cl2F6N2O and a molecular weight of 367.08 g/mol. Its IUPAC name is 3-amino-N-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4,4,4-trifluorobut-2-enamide.
| Compound Name | 3-amino-N-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4,4,4-trifluorobut-2-enamide |
|---|---|
| PubChem CID | 88506082 |
| Molecular Formula | C11H6Cl2F6N2O |
| Molecular Weight | 367.08 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | 3-amino-N-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4,4,4-trifluorobut-2-enamide |
| SMILES | NC(=CC(=O)Nc1c(Cl)cc(C(F)(F)F)cc1Cl)C(F)(F)F |
| InChI | InChI=1S/C11H6Cl2F6N2O/c12-5-1-4(10(14,15)16)2-6(13)9(5)21-8(22)3-7(20)11(17,18)19/h1-3H,20H2,(H,21,22) |
| InChIKey | ULFVLTSEIUTQPV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.08 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|