About 8-oxodeca-2,9-dienal
8-oxodeca-2,9-dienal (PubChem CID 88506212) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 8-oxodeca-2,9-dienal.
Molecular Properties
| Compound Name | 8-oxodeca-2,9-dienal |
| PubChem CID | 88506212 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 8-oxodeca-2,9-dienal |
| SMILES | C=CC(=O)CCCCC=CC=O |
| InChI | InChI=1S/C10H14O2/c1-2-10(12)8-6-4-3-5-7-9-11/h2,5,7,9H,1,3-4,6,8H2 |
| InChIKey | MOXRPOUPHJUXSW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 8-oxodeca-2,9-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-oxodeca-2,9-dienal?
The IUPAC name of 8-oxodeca-2,9-dienal (CID 88506212) is 8-oxodeca-2,9-dienal.
What is the SMILES notation for 8-oxodeca-2,9-dienal?
The canonical SMILES for 8-oxodeca-2,9-dienal is C=CC(=O)CCCCC=CC=O.
What is the InChIKey of 8-oxodeca-2,9-dienal?
The InChIKey is MOXRPOUPHJUXSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-2-10(12)8-6-4-3-5-7-9-11/h2,5,7,9H,1,3-4,6,8H2.
What are the key properties of 8-oxodeca-2,9-dienal?
8-oxodeca-2,9-dienal has a molecular weight of 166.22 g/mol, XLogP of 2.06, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-oxodeca-2,9-dienal is sourced from PubChem (CID 88506212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).