C10H17N3O4S — CID 88506541
4-diazo-N,N,2,5-tetramethylcyclohexa-1,5-dien-1-amine;sulfuric acid (PubChem CID 88506541) has the molecular formula C10H17N3O4S and a molecular weight of 275.33 g/mol. Its IUPAC name is 4-diazo-N,N,2,5-tetramethylcyclohexa-1,5-dien-1-amine;sulfuric acid.
| Compound Name | 4-diazo-N,N,2,5-tetramethylcyclohexa-1,5-dien-1-amine;sulfuric acid |
|---|---|
| PubChem CID | 88506541 |
| Molecular Formula | C10H17N3O4S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 4-diazo-N,N,2,5-tetramethylcyclohexa-1,5-dien-1-amine;sulfuric acid |
| SMILES | CC1=CC(N(C)C)=C(C)CC1=[N+]=[N-].O=S(=O)(O)O |
| InChI | InChI=1S/C10H15N3.H2O4S/c1-7-6-10(13(3)4)8(2)5-9(7)12-11;1-5(2,3)4/h6H,5H2,1-4H3;(H2,1,2,3,4) |
| InChIKey | RAOMMGOJATUNHY-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 114.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|