C18H23N3O4 — CID 88506641
2,3-dimethylbut-2-enoic acid;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 88506641) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2,3-dimethylbut-2-enoic acid;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3-dimethylbut-2-enoic acid;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 88506641 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 2,3-dimethylbut-2-enoic acid;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(C)=C(C)C(=O)O.O=C1C=C(N2CC2)C(=O)C(N2CC2)=C1N1CC1 |
| InChI | InChI=1S/C12H13N3O2.C6H10O2/c16-9-7-8(13-1-2-13)12(17)11(15-5-6-15)10(9)14-3-4-14;1-4(2)5(3)6(7)8/h7H,1-6H2;1-3H3,(H,7,8) |
| InChIKey | AZVPHCYGQQEGEH-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|