C15H16N2O — CID 88506814
(6aR,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline-5-carbaldehyde (PubChem CID 88506814) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is (6aR,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline-5-carbaldehyde.
| Compound Name | (6aR,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline-5-carbaldehyde |
|---|---|
| PubChem CID | 88506814 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | (6aR,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline-5-carbaldehyde |
| SMILES | O=Cc1[nH]c2cccc3c2c1C[C@H]1NCCC[C@H]31 |
| InChI | InChI=1S/C15H16N2O/c18-8-14-11-7-13-9(4-2-6-16-13)10-3-1-5-12(17-14)15(10)11/h1,3,5,8-9,13,16-17H,2,4,6-7H2/t9-,13-/m1/s1 |
| InChIKey | WHVGGHMFQVJFPK-NOZJJQNGSA-N |
| XLogP | 2.37 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|