About N,N-dimethylformamide;1,1,2-trichloroethene
N,N-dimethylformamide;1,1,2-trichloroethene (PubChem CID 88507276) has the molecular formula C5H8Cl3NO
and a molecular weight of 204.48 g/mol. Its IUPAC name is N,N-dimethylformamide;1,1,2-trichloroethene.
Molecular Properties
| Compound Name | N,N-dimethylformamide;1,1,2-trichloroethene |
| PubChem CID | 88507276 |
| Molecular Formula | C5H8Cl3NO |
| Molecular Weight | 204.48 g/mol |
| Exact Mass | 202.97 |
| IUPAC Name | N,N-dimethylformamide;1,1,2-trichloroethene |
| SMILES | CN(C)C=O.ClC=C(Cl)Cl |
| InChI | InChI=1S/C3H7NO.C2HCl3/c1-4(2)3-5;3-1-2(4)5/h3H,1-2H3;1H |
| InChIKey | IPUBWNOXVQSUFA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.48 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylformamide;1,1,2-trichloroethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylformamide;1,1,2-trichloroethene?
The IUPAC name of N,N-dimethylformamide;1,1,2-trichloroethene (CID 88507276) is N,N-dimethylformamide;1,1,2-trichloroethene.
What is the SMILES notation for N,N-dimethylformamide;1,1,2-trichloroethene?
The canonical SMILES for N,N-dimethylformamide;1,1,2-trichloroethene is CN(C)C=O.ClC=C(Cl)Cl.
What is the InChIKey of N,N-dimethylformamide;1,1,2-trichloroethene?
The InChIKey is IPUBWNOXVQSUFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.C2HCl3/c1-4(2)3-5;3-1-2(4)5/h3H,1-2H3;1H.
What are the key properties of N,N-dimethylformamide;1,1,2-trichloroethene?
N,N-dimethylformamide;1,1,2-trichloroethene has a molecular weight of 204.48 g/mol, XLogP of 2.21, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylformamide;1,1,2-trichloroethene is sourced from PubChem (CID 88507276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).