About 2-methoxy-6,6-bis(methylsulfonyl)-5-nitrocyclohexa-1,3-diene
2-methoxy-6,6-bis(methylsulfonyl)-5-nitrocyclohexa-1,3-diene (PubChem CID 88507934) has the molecular formula C9H13NO7S2
and a molecular weight of 311.34 g/mol. Its IUPAC name is 2-methoxy-6,6-bis(methylsulfonyl)-5-nitrocyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2-methoxy-6,6-bis(methylsulfonyl)-5-nitrocyclohexa-1,3-diene |
| PubChem CID | 88507934 |
| Molecular Formula | C9H13NO7S2 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 2-methoxy-6,6-bis(methylsulfonyl)-5-nitrocyclohexa-1,3-diene |
| SMILES | COC1=CC(S(C)(=O)=O)(S(C)(=O)=O)C([N+](=O)[O-])C=C1 |
| InChI | InChI=1S/C9H13NO7S2/c1-17-7-4-5-8(10(11)12)9(6-7,18(2,13)14)19(3,15)16/h4-6,8H,1-3H3 |
| InChIKey | QHNUOZXSUPUVRD-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 120.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-6,6-bis(methylsulfonyl)-5-nitrocyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-6,6-bis(methylsulfonyl)-5-nitrocyclohexa-1,3-diene?
The IUPAC name of 2-methoxy-6,6-bis(methylsulfonyl)-5-nitrocyclohexa-1,3-diene (CID 88507934) is 2-methoxy-6,6-bis(methylsulfonyl)-5-nitrocyclohexa-1,3-diene.
What is the SMILES notation for 2-methoxy-6,6-bis(methylsulfonyl)-5-nitrocyclohexa-1,3-diene?
The canonical SMILES for 2-methoxy-6,6-bis(methylsulfonyl)-5-nitrocyclohexa-1,3-diene is COC1=CC(S(C)(=O)=O)(S(C)(=O)=O)C([N+](=O)[O-])C=C1.
What is the InChIKey of 2-methoxy-6,6-bis(methylsulfonyl)-5-nitrocyclohexa-1,3-diene?
The InChIKey is QHNUOZXSUPUVRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO7S2/c1-17-7-4-5-8(10(11)12)9(6-7,18(2,13)14)19(3,15)16/h4-6,8H,1-3H3.
What are the key properties of 2-methoxy-6,6-bis(methylsulfonyl)-5-nitrocyclohexa-1,3-diene?
2-methoxy-6,6-bis(methylsulfonyl)-5-nitrocyclohexa-1,3-diene has a molecular weight of 311.34 g/mol, XLogP of -0.48, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-6,6-bis(methylsulfonyl)-5-nitrocyclohexa-1,3-diene is sourced from PubChem (CID 88507934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).