About 7-chloro-2,3-dimethyl-4-(2-methylpropyl)-1H-pyrrolo[2,3-d]pyridazine
7-chloro-2,3-dimethyl-4-(2-methylpropyl)-1H-pyrrolo[2,3-d]pyridazine (PubChem CID 88508122) has the molecular formula C12H16ClN3
and a molecular weight of 237.73 g/mol. Its IUPAC name is 7-chloro-2,3-dimethyl-4-(2-methylpropyl)-1H-pyrrolo[2,3-d]pyridazine.
Molecular Properties
| Compound Name | 7-chloro-2,3-dimethyl-4-(2-methylpropyl)-1H-pyrrolo[2,3-d]pyridazine |
| PubChem CID | 88508122 |
| Molecular Formula | C12H16ClN3 |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 7-chloro-2,3-dimethyl-4-(2-methylpropyl)-1H-pyrrolo[2,3-d]pyridazine |
| SMILES | Cc1[nH]c2c(Cl)nnc(CC(C)C)c2c1C |
| InChI | InChI=1S/C12H16ClN3/c1-6(2)5-9-10-7(3)8(4)14-11(10)12(13)16-15-9/h6,14H,5H2,1-4H3 |
| InChIKey | UCWQWDGDUKQKNK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-chloro-2,3-dimethyl-4-(2-methylpropyl)-1H-pyrrolo[2,3-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2,3-dimethyl-4-(2-methylpropyl)-1H-pyrrolo[2,3-d]pyridazine?
The IUPAC name of 7-chloro-2,3-dimethyl-4-(2-methylpropyl)-1H-pyrrolo[2,3-d]pyridazine (CID 88508122) is 7-chloro-2,3-dimethyl-4-(2-methylpropyl)-1H-pyrrolo[2,3-d]pyridazine.
What is the SMILES notation for 7-chloro-2,3-dimethyl-4-(2-methylpropyl)-1H-pyrrolo[2,3-d]pyridazine?
The canonical SMILES for 7-chloro-2,3-dimethyl-4-(2-methylpropyl)-1H-pyrrolo[2,3-d]pyridazine is Cc1[nH]c2c(Cl)nnc(CC(C)C)c2c1C.
What is the InChIKey of 7-chloro-2,3-dimethyl-4-(2-methylpropyl)-1H-pyrrolo[2,3-d]pyridazine?
The InChIKey is UCWQWDGDUKQKNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClN3/c1-6(2)5-9-10-7(3)8(4)14-11(10)12(13)16-15-9/h6,14H,5H2,1-4H3.
What are the key properties of 7-chloro-2,3-dimethyl-4-(2-methylpropyl)-1H-pyrrolo[2,3-d]pyridazine?
7-chloro-2,3-dimethyl-4-(2-methylpropyl)-1H-pyrrolo[2,3-d]pyridazine has a molecular weight of 237.73 g/mol, XLogP of 3.43, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2,3-dimethyl-4-(2-methylpropyl)-1H-pyrrolo[2,3-d]pyridazine is sourced from PubChem (CID 88508122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).