About 1-isocyanato-4-(2-isocyanatoethyl)benzene;1-isocyanato-3-(1-isocyanatopentyl)benzene
1-isocyanato-4-(2-isocyanatoethyl)benzene;1-isocyanato-3-(1-isocyanatopentyl)benzene (PubChem CID 88508511) has the molecular formula C23H22N4O4
and a molecular weight of 418.45 g/mol. Its IUPAC name is 1-isocyanato-4-(2-isocyanatoethyl)benzene;1-isocyanato-3-(1-isocyanatopentyl)benzene.
Molecular Properties
| Compound Name | 1-isocyanato-4-(2-isocyanatoethyl)benzene;1-isocyanato-3-(1-isocyanatopentyl)benzene |
| PubChem CID | 88508511 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 1-isocyanato-4-(2-isocyanatoethyl)benzene;1-isocyanato-3-(1-isocyanatopentyl)benzene |
| SMILES | CCCCC(N=C=O)c1cccc(N=C=O)c1.O=C=NCCc1ccc(N=C=O)cc1 |
| InChI | InChI=1S/C13H14N2O2.C10H8N2O2/c1-2-3-7-13(15-10-17)11-5-4-6-12(8-11)14-9-16;13-7-11-6-5-9-1-3-10(4-2-9)12-8-14/h4-6,8,13H,2-3,7H2,1H3;1-4H,5-6H2 |
| InChIKey | OYWQFJLPTCKHCH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1-isocyanato-4-(2-isocyanatoethyl)benzene;1-isocyanato-3-(1-isocyanatopentyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isocyanato-4-(2-isocyanatoethyl)benzene;1-isocyanato-3-(1-isocyanatopentyl)benzene?
The IUPAC name of 1-isocyanato-4-(2-isocyanatoethyl)benzene;1-isocyanato-3-(1-isocyanatopentyl)benzene (CID 88508511) is 1-isocyanato-4-(2-isocyanatoethyl)benzene;1-isocyanato-3-(1-isocyanatopentyl)benzene.
What is the SMILES notation for 1-isocyanato-4-(2-isocyanatoethyl)benzene;1-isocyanato-3-(1-isocyanatopentyl)benzene?
The canonical SMILES for 1-isocyanato-4-(2-isocyanatoethyl)benzene;1-isocyanato-3-(1-isocyanatopentyl)benzene is CCCCC(N=C=O)c1cccc(N=C=O)c1.O=C=NCCc1ccc(N=C=O)cc1.
What is the InChIKey of 1-isocyanato-4-(2-isocyanatoethyl)benzene;1-isocyanato-3-(1-isocyanatopentyl)benzene?
The InChIKey is OYWQFJLPTCKHCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2.C10H8N2O2/c1-2-3-7-13(15-10-17)11-5-4-6-12(8-11)14-9-16;13-7-11-6-5-9-1-3-10(4-2-9)12-8-14/h4-6,8,13H,2-3,7H2,1H3;1-4H,5-6H2.
What are the key properties of 1-isocyanato-4-(2-isocyanatoethyl)benzene;1-isocyanato-3-(1-isocyanatopentyl)benzene?
1-isocyanato-4-(2-isocyanatoethyl)benzene;1-isocyanato-3-(1-isocyanatopentyl)benzene has a molecular weight of 418.45 g/mol, XLogP of 4.75, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isocyanato-4-(2-isocyanatoethyl)benzene;1-isocyanato-3-(1-isocyanatopentyl)benzene is sourced from PubChem (CID 88508511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).