About cyclopentanone;6-oxabicyclo[3.1.0]hexan-2-one
cyclopentanone;6-oxabicyclo[3.1.0]hexan-2-one (PubChem CID 88508722) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is cyclopentanone;6-oxabicyclo[3.1.0]hexan-2-one.
Molecular Properties
| Compound Name | cyclopentanone;6-oxabicyclo[3.1.0]hexan-2-one |
| PubChem CID | 88508722 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | cyclopentanone;6-oxabicyclo[3.1.0]hexan-2-one |
| SMILES | O=C1CCC2OC12.O=C1CCCC1 |
| InChI | InChI=1S/C5H6O2.C5H8O/c6-3-1-2-4-5(3)7-4;6-5-3-1-2-4-5/h4-5H,1-2H2;1-4H2 |
| InChIKey | IRYWDZRMLPPUHJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze cyclopentanone;6-oxabicyclo[3.1.0]hexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentanone;6-oxabicyclo[3.1.0]hexan-2-one?
The IUPAC name of cyclopentanone;6-oxabicyclo[3.1.0]hexan-2-one (CID 88508722) is cyclopentanone;6-oxabicyclo[3.1.0]hexan-2-one.
What is the SMILES notation for cyclopentanone;6-oxabicyclo[3.1.0]hexan-2-one?
The canonical SMILES for cyclopentanone;6-oxabicyclo[3.1.0]hexan-2-one is O=C1CCC2OC12.O=C1CCCC1.
What is the InChIKey of cyclopentanone;6-oxabicyclo[3.1.0]hexan-2-one?
The InChIKey is IRYWDZRMLPPUHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O2.C5H8O/c6-3-1-2-4-5(3)7-4;6-5-3-1-2-4-5/h4-5H,1-2H2;1-4H2.
What are the key properties of cyclopentanone;6-oxabicyclo[3.1.0]hexan-2-one?
cyclopentanone;6-oxabicyclo[3.1.0]hexan-2-one has a molecular weight of 182.22 g/mol, XLogP of 1.25, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentanone;6-oxabicyclo[3.1.0]hexan-2-one is sourced from PubChem (CID 88508722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).