About N'-ethyl-N'-phosphanylethane-1,2-diamine
N'-ethyl-N'-phosphanylethane-1,2-diamine (PubChem CID 88508729) has the molecular formula C4H13N2P
and a molecular weight of 120.14 g/mol. Its IUPAC name is N'-ethyl-N'-phosphanylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-ethyl-N'-phosphanylethane-1,2-diamine |
| PubChem CID | 88508729 |
| Molecular Formula | C4H13N2P |
| Molecular Weight | 120.14 g/mol |
| Exact Mass | 120.08 |
| IUPAC Name | N'-ethyl-N'-phosphanylethane-1,2-diamine |
| SMILES | CCN(P)CCN |
| InChI | InChI=1S/C4H13N2P/c1-2-6(7)4-3-5/h2-5,7H2,1H3 |
| InChIKey | NGJSGDWIFRFZJW-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.14 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N'-ethyl-N'-phosphanylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N'-phosphanylethane-1,2-diamine?
The IUPAC name of N'-ethyl-N'-phosphanylethane-1,2-diamine (CID 88508729) is N'-ethyl-N'-phosphanylethane-1,2-diamine.
What is the SMILES notation for N'-ethyl-N'-phosphanylethane-1,2-diamine?
The canonical SMILES for N'-ethyl-N'-phosphanylethane-1,2-diamine is CCN(P)CCN.
What is the InChIKey of N'-ethyl-N'-phosphanylethane-1,2-diamine?
The InChIKey is NGJSGDWIFRFZJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H13N2P/c1-2-6(7)4-3-5/h2-5,7H2,1H3.
What are the key properties of N'-ethyl-N'-phosphanylethane-1,2-diamine?
N'-ethyl-N'-phosphanylethane-1,2-diamine has a molecular weight of 120.14 g/mol, XLogP of 0.06, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N'-phosphanylethane-1,2-diamine is sourced from PubChem (CID 88508729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).