C14H11NOSe — CID 88509492
N-benzyl-7-selenabicyclo[4.1.0]hepta-1,3,5-triene-2-carboxamide (PubChem CID 88509492) has the molecular formula C14H11NOSe and a molecular weight of 288.21 g/mol. Its IUPAC name is N-benzyl-7-selenabicyclo[4.1.0]hepta-1,3,5-triene-2-carboxamide.
| Compound Name | N-benzyl-7-selenabicyclo[4.1.0]hepta-1,3,5-triene-2-carboxamide |
|---|---|
| PubChem CID | 88509492 |
| Molecular Formula | C14H11NOSe |
| Molecular Weight | 288.21 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | N-benzyl-7-selenabicyclo[4.1.0]hepta-1,3,5-triene-2-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1cccc2c1[Se]2 |
| InChI | InChI=1S/C14H11NOSe/c16-14(11-7-4-8-12-13(11)17-12)15-9-10-5-2-1-3-6-10/h1-8H,9H2,(H,15,16) |
| InChIKey | OGXNGDOLDIZFBY-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.21 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|