About 6-(4-isocyanatophenoxy)-2,2-dimethyl-3,4-dihydrochromene
6-(4-isocyanatophenoxy)-2,2-dimethyl-3,4-dihydrochromene (PubChem CID 88509714) has the molecular formula C18H17NO3
and a molecular weight of 295.34 g/mol. Its IUPAC name is 6-(4-isocyanatophenoxy)-2,2-dimethyl-3,4-dihydrochromene.
Molecular Properties
| Compound Name | 6-(4-isocyanatophenoxy)-2,2-dimethyl-3,4-dihydrochromene |
| PubChem CID | 88509714 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 6-(4-isocyanatophenoxy)-2,2-dimethyl-3,4-dihydrochromene |
| SMILES | CC1(C)CCc2cc(Oc3ccc(N=C=O)cc3)ccc2O1 |
| InChI | InChI=1S/C18H17NO3/c1-18(2)10-9-13-11-16(7-8-17(13)22-18)21-15-5-3-14(4-6-15)19-12-20/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | QUCXZXKALXLKET-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-isocyanatophenoxy)-2,2-dimethyl-3,4-dihydrochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-isocyanatophenoxy)-2,2-dimethyl-3,4-dihydrochromene?
The IUPAC name of 6-(4-isocyanatophenoxy)-2,2-dimethyl-3,4-dihydrochromene (CID 88509714) is 6-(4-isocyanatophenoxy)-2,2-dimethyl-3,4-dihydrochromene.
What is the SMILES notation for 6-(4-isocyanatophenoxy)-2,2-dimethyl-3,4-dihydrochromene?
The canonical SMILES for 6-(4-isocyanatophenoxy)-2,2-dimethyl-3,4-dihydrochromene is CC1(C)CCc2cc(Oc3ccc(N=C=O)cc3)ccc2O1.
What is the InChIKey of 6-(4-isocyanatophenoxy)-2,2-dimethyl-3,4-dihydrochromene?
The InChIKey is QUCXZXKALXLKET-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO3/c1-18(2)10-9-13-11-16(7-8-17(13)22-18)21-15-5-3-14(4-6-15)19-12-20/h3-8,11H,9-10H2,1-2H3.
What are the key properties of 6-(4-isocyanatophenoxy)-2,2-dimethyl-3,4-dihydrochromene?
6-(4-isocyanatophenoxy)-2,2-dimethyl-3,4-dihydrochromene has a molecular weight of 295.34 g/mol, XLogP of 4.55, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-isocyanatophenoxy)-2,2-dimethyl-3,4-dihydrochromene is sourced from PubChem (CID 88509714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).