About (8-acetyl-1,3,7-trihydroxy-9a-methyl-9-oxodibenzofuran-4-yl)urea
(8-acetyl-1,3,7-trihydroxy-9a-methyl-9-oxodibenzofuran-4-yl)urea (PubChem CID 88509801) has the molecular formula C16H14N2O7
and a molecular weight of 346.30 g/mol. Its IUPAC name is (8-acetyl-1,3,7-trihydroxy-9a-methyl-9-oxodibenzofuran-4-yl)urea.
Molecular Properties
| Compound Name | (8-acetyl-1,3,7-trihydroxy-9a-methyl-9-oxodibenzofuran-4-yl)urea |
| PubChem CID | 88509801 |
| Molecular Formula | C16H14N2O7 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | (8-acetyl-1,3,7-trihydroxy-9a-methyl-9-oxodibenzofuran-4-yl)urea |
| SMILES | CC(=O)C1=C(O)C=C2Oc3c(NC(N)=O)c(O)cc(O)c3C2(C)C1=O |
| InChI | InChI=1S/C16H14N2O7/c1-5(19)10-6(20)4-9-16(2,14(10)23)11-7(21)3-8(22)12(13(11)25-9)18-15(17)24/h3-4,20-22H,1-2H3,(H3,17,18,24) |
| InChIKey | WWCNUJLFYVRVTD-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 159.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze (8-acetyl-1,3,7-trihydroxy-9a-methyl-9-oxodibenzofuran-4-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-acetyl-1,3,7-trihydroxy-9a-methyl-9-oxodibenzofuran-4-yl)urea?
The IUPAC name of (8-acetyl-1,3,7-trihydroxy-9a-methyl-9-oxodibenzofuran-4-yl)urea (CID 88509801) is (8-acetyl-1,3,7-trihydroxy-9a-methyl-9-oxodibenzofuran-4-yl)urea.
What is the SMILES notation for (8-acetyl-1,3,7-trihydroxy-9a-methyl-9-oxodibenzofuran-4-yl)urea?
The canonical SMILES for (8-acetyl-1,3,7-trihydroxy-9a-methyl-9-oxodibenzofuran-4-yl)urea is CC(=O)C1=C(O)C=C2Oc3c(NC(N)=O)c(O)cc(O)c3C2(C)C1=O.
What is the InChIKey of (8-acetyl-1,3,7-trihydroxy-9a-methyl-9-oxodibenzofuran-4-yl)urea?
The InChIKey is WWCNUJLFYVRVTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O7/c1-5(19)10-6(20)4-9-16(2,14(10)23)11-7(21)3-8(22)12(13(11)25-9)18-15(17)24/h3-4,20-22H,1-2H3,(H3,17,18,24).
What are the key properties of (8-acetyl-1,3,7-trihydroxy-9a-methyl-9-oxodibenzofuran-4-yl)urea?
(8-acetyl-1,3,7-trihydroxy-9a-methyl-9-oxodibenzofuran-4-yl)urea has a molecular weight of 346.30 g/mol, XLogP of 1.11, 2 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (8-acetyl-1,3,7-trihydroxy-9a-methyl-9-oxodibenzofuran-4-yl)urea is sourced from PubChem (CID 88509801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).