About 4-methyl-1-[2,4,6-trihydroxy-3-methyl-5-(4-methylpentanoyl)phenyl]pentan-1-one
4-methyl-1-[2,4,6-trihydroxy-3-methyl-5-(4-methylpentanoyl)phenyl]pentan-1-one (PubChem CID 88510407) has the molecular formula C19H28O5
and a molecular weight of 336.43 g/mol. Its IUPAC name is 4-methyl-1-[2,4,6-trihydroxy-3-methyl-5-(4-methylpentanoyl)phenyl]pentan-1-one.
Molecular Properties
| Compound Name | 4-methyl-1-[2,4,6-trihydroxy-3-methyl-5-(4-methylpentanoyl)phenyl]pentan-1-one |
| PubChem CID | 88510407 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 4-methyl-1-[2,4,6-trihydroxy-3-methyl-5-(4-methylpentanoyl)phenyl]pentan-1-one |
| SMILES | Cc1c(O)c(C(=O)CCC(C)C)c(O)c(C(=O)CCC(C)C)c1O |
| InChI | InChI=1S/C19H28O5/c1-10(2)6-8-13(20)15-17(22)12(5)18(23)16(19(15)24)14(21)9-7-11(3)4/h10-11,22-24H,6-9H2,1-5H3 |
| InChIKey | ZHNVMKKPVXTHBV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methyl-1-[2,4,6-trihydroxy-3-methyl-5-(4-methylpentanoyl)phenyl]pentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-[2,4,6-trihydroxy-3-methyl-5-(4-methylpentanoyl)phenyl]pentan-1-one?
The IUPAC name of 4-methyl-1-[2,4,6-trihydroxy-3-methyl-5-(4-methylpentanoyl)phenyl]pentan-1-one (CID 88510407) is 4-methyl-1-[2,4,6-trihydroxy-3-methyl-5-(4-methylpentanoyl)phenyl]pentan-1-one.
What is the SMILES notation for 4-methyl-1-[2,4,6-trihydroxy-3-methyl-5-(4-methylpentanoyl)phenyl]pentan-1-one?
The canonical SMILES for 4-methyl-1-[2,4,6-trihydroxy-3-methyl-5-(4-methylpentanoyl)phenyl]pentan-1-one is Cc1c(O)c(C(=O)CCC(C)C)c(O)c(C(=O)CCC(C)C)c1O.
What is the InChIKey of 4-methyl-1-[2,4,6-trihydroxy-3-methyl-5-(4-methylpentanoyl)phenyl]pentan-1-one?
The InChIKey is ZHNVMKKPVXTHBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28O5/c1-10(2)6-8-13(20)15-17(22)12(5)18(23)16(19(15)24)14(21)9-7-11(3)4/h10-11,22-24H,6-9H2,1-5H3.
What are the key properties of 4-methyl-1-[2,4,6-trihydroxy-3-methyl-5-(4-methylpentanoyl)phenyl]pentan-1-one?
4-methyl-1-[2,4,6-trihydroxy-3-methyl-5-(4-methylpentanoyl)phenyl]pentan-1-one has a molecular weight of 336.43 g/mol, XLogP of 4.35, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-[2,4,6-trihydroxy-3-methyl-5-(4-methylpentanoyl)phenyl]pentan-1-one is sourced from PubChem (CID 88510407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).