C21H24O5S — CID 88510549
methyl (1S,2R,4S)-4-(4-methylphenyl)sulfonyloxy-2-phenylcyclohexane-1-carboxylate (PubChem CID 88510549) has the molecular formula C21H24O5S and a molecular weight of 388.49 g/mol. Its IUPAC name is methyl (1S,2R,4S)-4-(4-methylphenyl)sulfonyloxy-2-phenylcyclohexane-1-carboxylate.
| Compound Name | methyl (1S,2R,4S)-4-(4-methylphenyl)sulfonyloxy-2-phenylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 88510549 |
| Molecular Formula | C21H24O5S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | methyl (1S,2R,4S)-4-(4-methylphenyl)sulfonyloxy-2-phenylcyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@H]1CC[C@H](OS(=O)(=O)c2ccc(C)cc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H24O5S/c1-15-8-11-18(12-9-15)27(23,24)26-17-10-13-19(21(22)25-2)20(14-17)16-6-4-3-5-7-16/h3-9,11-12,17,19-20H,10,13-14H2,1-2H3/t17-,19-,20-/m0/s1 |
| InChIKey | PEZXLAMILHIHNA-IHPCNDPISA-N |
| XLogP | 3.83 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|