C27H29FO5S — CID 88510680
[(1S,2R,3R,4R)-2-fluoro-3,4-bis(phenylmethoxymethyl)cyclobutyl] 4-methylbenzenesulfonate (PubChem CID 88510680) has the molecular formula C27H29FO5S and a molecular weight of 484.59 g/mol. Its IUPAC name is [(1S,2R,3R,4R)-2-fluoro-3,4-bis(phenylmethoxymethyl)cyclobutyl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,2R,3R,4R)-2-fluoro-3,4-bis(phenylmethoxymethyl)cyclobutyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 88510680 |
| Molecular Formula | C27H29FO5S |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | [(1S,2R,3R,4R)-2-fluoro-3,4-bis(phenylmethoxymethyl)cyclobutyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2[C@H](F)[C@@H](COCc3ccccc3)[C@@H]2COCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H29FO5S/c1-20-12-14-23(15-13-20)34(29,30)33-27-25(19-32-17-22-10-6-3-7-11-22)24(26(27)28)18-31-16-21-8-4-2-5-9-21/h2-15,24-27H,16-19H2,1H3/t24-,25-,26+,27-/m0/s1 |
| InChIKey | FHUYEXRZQWAZSF-NFGXINMFSA-N |
| XLogP | 5.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|