C16H27FO3S — CID 88511182
(1R,6S)-6-(2-fluorooctyl)-1,4-dimethylcyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 88511182) has the molecular formula C16H27FO3S and a molecular weight of 318.45 g/mol. Its IUPAC name is (1R,6S)-6-(2-fluorooctyl)-1,4-dimethylcyclohexa-2,4-diene-1-sulfonic acid.
| Compound Name | (1R,6S)-6-(2-fluorooctyl)-1,4-dimethylcyclohexa-2,4-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 88511182 |
| Molecular Formula | C16H27FO3S |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (1R,6S)-6-(2-fluorooctyl)-1,4-dimethylcyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | CCCCCCC(F)C[C@H]1C=C(C)C=C[C@@]1(C)S(=O)(=O)O |
| InChI | InChI=1S/C16H27FO3S/c1-4-5-6-7-8-15(17)12-14-11-13(2)9-10-16(14,3)21(18,19)20/h9-11,14-15H,4-8,12H2,1-3H3,(H,18,19,20)/t14-,15?,16-/m1/s1 |
| InChIKey | GKCPLUBZGDTQLJ-YTPLPTRZSA-N |
| XLogP | 4.46 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|