About but-1-ynoxy-(2,3-dimethylbutan-2-yl)-dimethylsilane
but-1-ynoxy-(2,3-dimethylbutan-2-yl)-dimethylsilane (PubChem CID 88511350) has the molecular formula C12H24OSi
and a molecular weight of 212.41 g/mol. Its IUPAC name is but-1-ynoxy-(2,3-dimethylbutan-2-yl)-dimethylsilane.
Molecular Properties
| Compound Name | but-1-ynoxy-(2,3-dimethylbutan-2-yl)-dimethylsilane |
| PubChem CID | 88511350 |
| Molecular Formula | C12H24OSi |
| Molecular Weight | 212.41 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | but-1-ynoxy-(2,3-dimethylbutan-2-yl)-dimethylsilane |
| SMILES | CCC#CO[Si](C)(C)C(C)(C)C(C)C |
| InChI | InChI=1S/C12H24OSi/c1-8-9-10-13-14(6,7)12(4,5)11(2)3/h11H,8H2,1-7H3 |
| InChIKey | ARXWALGNYXVWIY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-1-ynoxy-(2,3-dimethylbutan-2-yl)-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ynoxy-(2,3-dimethylbutan-2-yl)-dimethylsilane?
The IUPAC name of but-1-ynoxy-(2,3-dimethylbutan-2-yl)-dimethylsilane (CID 88511350) is but-1-ynoxy-(2,3-dimethylbutan-2-yl)-dimethylsilane.
What is the SMILES notation for but-1-ynoxy-(2,3-dimethylbutan-2-yl)-dimethylsilane?
The canonical SMILES for but-1-ynoxy-(2,3-dimethylbutan-2-yl)-dimethylsilane is CCC#CO[Si](C)(C)C(C)(C)C(C)C.
What is the InChIKey of but-1-ynoxy-(2,3-dimethylbutan-2-yl)-dimethylsilane?
The InChIKey is ARXWALGNYXVWIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24OSi/c1-8-9-10-13-14(6,7)12(4,5)11(2)3/h11H,8H2,1-7H3.
What are the key properties of but-1-ynoxy-(2,3-dimethylbutan-2-yl)-dimethylsilane?
but-1-ynoxy-(2,3-dimethylbutan-2-yl)-dimethylsilane has a molecular weight of 212.41 g/mol, XLogP of 4.02, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ynoxy-(2,3-dimethylbutan-2-yl)-dimethylsilane is sourced from PubChem (CID 88511350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).